C17H30N2OS — CID 143468064
5-cyclohexyl-2-cyclohexylimino-1,3-thiazolidin-4-one;ethane (PubChem CID 143468064) has the molecular formula C17H30N2OS and a molecular weight of 310.51 g/mol. Its IUPAC name is 5-cyclohexyl-2-cyclohexylimino-1,3-thiazolidin-4-one;ethane.
| Compound Name | 5-cyclohexyl-2-cyclohexylimino-1,3-thiazolidin-4-one;ethane |
|---|---|
| PubChem CID | 143468064 |
| Molecular Formula | C17H30N2OS |
| Molecular Weight | 310.51 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | 5-cyclohexyl-2-cyclohexylimino-1,3-thiazolidin-4-one;ethane |
| SMILES | CC.O=C1N/C(=N/C2CCCCC2)SC1C1CCCCC1 |
| InChI | InChI=1S/C15H24N2OS.C2H6/c18-14-13(11-7-3-1-4-8-11)19-15(17-14)16-12-9-5-2-6-10-12;1-2/h11-13H,1-10H2,(H,16,17,18);1-2H3 |
| InChIKey | YJSGBGYNJCZTLR-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.51 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|