C26H35FN4O2S — CID 143468125
acetylene;(2E)-2-[(1S)-1-amino-1-(4-fluorophenyl)ethyl]imino-5-methyl-5-[(E)-prop-1-enyl]-1,3-thiazolidin-4-one;N-cyclopentylbut-3-enamide (PubChem CID 143468125) has the molecular formula C26H35FN4O2S and a molecular weight of 486.66 g/mol. Its IUPAC name is acetylene;(2E)-2-[(1S)-1-amino-1-(4-fluorophenyl)ethyl]imino-5-methyl-5-[(E)-prop-1-enyl]-1,3-thiazolidin-4-one;N-cyclopentylbut-3-enamide.
| Compound Name | acetylene;(2E)-2-[(1S)-1-amino-1-(4-fluorophenyl)ethyl]imino-5-methyl-5-[(E)-prop-1-enyl]-1,3-thiazolidin-4-one;N-cyclopentylbut-3-enamide |
|---|---|
| PubChem CID | 143468125 |
| Molecular Formula | C26H35FN4O2S |
| Molecular Weight | 486.66 g/mol |
| Exact Mass | 486.25 |
| IUPAC Name | acetylene;(2E)-2-[(1S)-1-amino-1-(4-fluorophenyl)ethyl]imino-5-methyl-5-[(E)-prop-1-enyl]-1,3-thiazolidin-4-one;N-cyclopentylbut-3-enamide |
| SMILES | C#C.C/C=C/C1(C)S/C(=N/[C@](C)(N)c2ccc(F)cc2)NC1=O.C=CCC(=O)NC1CCCC1 |
| InChI | InChI=1S/C15H18FN3OS.C9H15NO.C2H2/c1-4-9-14(2)12(20)18-13(21-14)19-15(3,17)10-5-7-11(16)8-6-10;1-2-5-9(11)10-8-6-3-4-7-8;1-2/h4-9H,17H2,1-3H3,(H,18,19,20);2,8H,1,3-7H2,(H,10,11);1-2H/b9-4+;;/t14?,15-;;/m0../s1 |
| InChIKey | GLSGWXCEYROHDZ-WPIXNCGMSA-N |
| XLogP | 4.38 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.66 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|