About 2-benzylimino-5-ethyl-5-methyl-1,3-thiazolidin-4-one;ethane;molecular hydrogen
2-benzylimino-5-ethyl-5-methyl-1,3-thiazolidin-4-one;ethane;molecular hydrogen (PubChem CID 143468326) has the molecular formula C15H24N2OS
and a molecular weight of 280.44 g/mol. Its IUPAC name is 2-benzylimino-5-ethyl-5-methyl-1,3-thiazolidin-4-one;ethane;molecular hydrogen.
Molecular Properties
| Compound Name | 2-benzylimino-5-ethyl-5-methyl-1,3-thiazolidin-4-one;ethane;molecular hydrogen |
| PubChem CID | 143468326 |
| Molecular Formula | C15H24N2OS |
| Molecular Weight | 280.44 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 2-benzylimino-5-ethyl-5-methyl-1,3-thiazolidin-4-one;ethane;molecular hydrogen |
| SMILES | CC.CCC1(C)S/C(=N/Cc2ccccc2)NC1=O.[H][H] |
| InChI | InChI=1S/C13H16N2OS.C2H6.H2/c1-3-13(2)11(16)15-12(17-13)14-9-10-7-5-4-6-8-10;1-2;/h4-8H,3,9H2,1-2H3,(H,14,15,16);1-2H3;1H |
| InChIKey | BAPXNLZVYJHCPO-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.44 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-benzylimino-5-ethyl-5-methyl-1,3-thiazolidin-4-one;ethane;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzylimino-5-ethyl-5-methyl-1,3-thiazolidin-4-one;ethane;molecular hydrogen?
The IUPAC name of 2-benzylimino-5-ethyl-5-methyl-1,3-thiazolidin-4-one;ethane;molecular hydrogen (CID 143468326) is 2-benzylimino-5-ethyl-5-methyl-1,3-thiazolidin-4-one;ethane;molecular hydrogen.
What is the SMILES notation for 2-benzylimino-5-ethyl-5-methyl-1,3-thiazolidin-4-one;ethane;molecular hydrogen?
The canonical SMILES for 2-benzylimino-5-ethyl-5-methyl-1,3-thiazolidin-4-one;ethane;molecular hydrogen is CC.CCC1(C)S/C(=N/Cc2ccccc2)NC1=O.[H][H].
What is the InChIKey of 2-benzylimino-5-ethyl-5-methyl-1,3-thiazolidin-4-one;ethane;molecular hydrogen?
The InChIKey is BAPXNLZVYJHCPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2OS.C2H6.H2/c1-3-13(2)11(16)15-12(17-13)14-9-10-7-5-4-6-8-10;1-2;/h4-8H,3,9H2,1-2H3,(H,14,15,16);1-2H3;1H.
What are the key properties of 2-benzylimino-5-ethyl-5-methyl-1,3-thiazolidin-4-one;ethane;molecular hydrogen?
2-benzylimino-5-ethyl-5-methyl-1,3-thiazolidin-4-one;ethane;molecular hydrogen has a molecular weight of 280.44 g/mol, XLogP of 3.85, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzylimino-5-ethyl-5-methyl-1,3-thiazolidin-4-one;ethane;molecular hydrogen is sourced from PubChem (CID 143468326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).