About (2E,3E)-3-[(Z)-but-2-enylidene]-2-ethylideneoxan-4-one;ethane
(2E,3E)-3-[(Z)-but-2-enylidene]-2-ethylideneoxan-4-one;ethane (PubChem CID 143468347) has the molecular formula C13H20O2
and a molecular weight of 208.30 g/mol. Its IUPAC name is (2E,3E)-3-[(Z)-but-2-enylidene]-2-ethylideneoxan-4-one;ethane.
Molecular Properties
| Compound Name | (2E,3E)-3-[(Z)-but-2-enylidene]-2-ethylideneoxan-4-one;ethane |
| PubChem CID | 143468347 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | (2E,3E)-3-[(Z)-but-2-enylidene]-2-ethylideneoxan-4-one;ethane |
| SMILES | C/C=C\C=C1\C(=O)CCO\C1=C\C.CC |
| InChI | InChI=1S/C11H14O2.C2H6/c1-3-5-6-9-10(12)7-8-13-11(9)4-2;1-2/h3-6H,7-8H2,1-2H3;1-2H3/b5-3-,9-6-,11-4+; |
| InChIKey | YCXYENHPCPMNRS-ROFOTKPFSA-N |
| XLogP | 3.41 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2E,3E)-3-[(Z)-but-2-enylidene]-2-ethylideneoxan-4-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,3E)-3-[(Z)-but-2-enylidene]-2-ethylideneoxan-4-one;ethane?
The IUPAC name of (2E,3E)-3-[(Z)-but-2-enylidene]-2-ethylideneoxan-4-one;ethane (CID 143468347) is (2E,3E)-3-[(Z)-but-2-enylidene]-2-ethylideneoxan-4-one;ethane.
What is the SMILES notation for (2E,3E)-3-[(Z)-but-2-enylidene]-2-ethylideneoxan-4-one;ethane?
The canonical SMILES for (2E,3E)-3-[(Z)-but-2-enylidene]-2-ethylideneoxan-4-one;ethane is C/C=C\C=C1\C(=O)CCO\C1=C\C.CC.
What is the InChIKey of (2E,3E)-3-[(Z)-but-2-enylidene]-2-ethylideneoxan-4-one;ethane?
The InChIKey is YCXYENHPCPMNRS-ROFOTKPFSA-N. The full InChI is InChI=1S/C11H14O2.C2H6/c1-3-5-6-9-10(12)7-8-13-11(9)4-2;1-2/h3-6H,7-8H2,1-2H3;1-2H3/b5-3-,9-6-,11-4+;.
What are the key properties of (2E,3E)-3-[(Z)-but-2-enylidene]-2-ethylideneoxan-4-one;ethane?
(2E,3E)-3-[(Z)-but-2-enylidene]-2-ethylideneoxan-4-one;ethane has a molecular weight of 208.30 g/mol, XLogP of 3.41, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,3E)-3-[(Z)-but-2-enylidene]-2-ethylideneoxan-4-one;ethane is sourced from PubChem (CID 143468347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).