C14H20F2N2OS — CID 143468390
N-[(2-fluorophenyl)methylcarbamothioyl]propanamide;2-fluoropropane (PubChem CID 143468390) has the molecular formula C14H20F2N2OS and a molecular weight of 302.39 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methylcarbamothioyl]propanamide;2-fluoropropane.
| Compound Name | N-[(2-fluorophenyl)methylcarbamothioyl]propanamide;2-fluoropropane |
|---|---|
| PubChem CID | 143468390 |
| Molecular Formula | C14H20F2N2OS |
| Molecular Weight | 302.39 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | N-[(2-fluorophenyl)methylcarbamothioyl]propanamide;2-fluoropropane |
| SMILES | CC(C)F.CCC(=O)NC(=S)NCc1ccccc1F |
| InChI | InChI=1S/C11H13FN2OS.C3H7F/c1-2-10(15)14-11(16)13-7-8-5-3-4-6-9(8)12;1-3(2)4/h3-6H,2,7H2,1H3,(H2,13,14,15,16);3H,1-2H3 |
| InChIKey | HJAKCKIXOAOSDD-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.39 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|