C13H16N4O — CID 143468717
5,6-diamino-1'-methyl-2'-methylidenespiro[1,3-dihydroindene-2,5'-imidazolidine]-4'-one (PubChem CID 143468717) has the molecular formula C13H16N4O and a molecular weight of 244.30 g/mol. Its IUPAC name is 5,6-diamino-1'-methyl-2'-methylidenespiro[1,3-dihydroindene-2,5'-imidazolidine]-4'-one.
| Compound Name | 5,6-diamino-1'-methyl-2'-methylidenespiro[1,3-dihydroindene-2,5'-imidazolidine]-4'-one |
|---|---|
| PubChem CID | 143468717 |
| Molecular Formula | C13H16N4O |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 5,6-diamino-1'-methyl-2'-methylidenespiro[1,3-dihydroindene-2,5'-imidazolidine]-4'-one |
| SMILES | C=C1NC(=O)C2(Cc3cc(N)c(N)cc3C2)N1C |
| InChI | InChI=1S/C13H16N4O/c1-7-16-12(18)13(17(7)2)5-8-3-10(14)11(15)4-9(8)6-13/h3-4H,1,5-6,14-15H2,2H3,(H,16,18) |
| InChIKey | LPNAHIJTQIRERB-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 84.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|