About 4-ethenyl-5-methyl-3H-1,3-oxazol-2-one;2-methylpent-2-ene
4-ethenyl-5-methyl-3H-1,3-oxazol-2-one;2-methylpent-2-ene (PubChem CID 143469015) has the molecular formula C12H19NO2
and a molecular weight of 209.29 g/mol. Its IUPAC name is 4-ethenyl-5-methyl-3H-1,3-oxazol-2-one;2-methylpent-2-ene.
Molecular Properties
| Compound Name | 4-ethenyl-5-methyl-3H-1,3-oxazol-2-one;2-methylpent-2-ene |
| PubChem CID | 143469015 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | 4-ethenyl-5-methyl-3H-1,3-oxazol-2-one;2-methylpent-2-ene |
| SMILES | C=Cc1[nH]c(=O)oc1C.CCC=C(C)C |
| InChI | InChI=1S/C6H7NO2.C6H12/c1-3-5-4(2)9-6(8)7-5;1-4-5-6(2)3/h3H,1H2,2H3,(H,7,8);5H,4H2,1-3H3 |
| InChIKey | GMHHXRUZZGMVDL-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 46.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-ethenyl-5-methyl-3H-1,3-oxazol-2-one;2-methylpent-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenyl-5-methyl-3H-1,3-oxazol-2-one;2-methylpent-2-ene?
The IUPAC name of 4-ethenyl-5-methyl-3H-1,3-oxazol-2-one;2-methylpent-2-ene (CID 143469015) is 4-ethenyl-5-methyl-3H-1,3-oxazol-2-one;2-methylpent-2-ene.
What is the SMILES notation for 4-ethenyl-5-methyl-3H-1,3-oxazol-2-one;2-methylpent-2-ene?
The canonical SMILES for 4-ethenyl-5-methyl-3H-1,3-oxazol-2-one;2-methylpent-2-ene is C=Cc1[nH]c(=O)oc1C.CCC=C(C)C.
What is the InChIKey of 4-ethenyl-5-methyl-3H-1,3-oxazol-2-one;2-methylpent-2-ene?
The InChIKey is GMHHXRUZZGMVDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO2.C6H12/c1-3-5-4(2)9-6(8)7-5;1-4-5-6(2)3/h3H,1H2,2H3,(H,7,8);5H,4H2,1-3H3.
What are the key properties of 4-ethenyl-5-methyl-3H-1,3-oxazol-2-one;2-methylpent-2-ene?
4-ethenyl-5-methyl-3H-1,3-oxazol-2-one;2-methylpent-2-ene has a molecular weight of 209.29 g/mol, XLogP of 3.28, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenyl-5-methyl-3H-1,3-oxazol-2-one;2-methylpent-2-ene is sourced from PubChem (CID 143469015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).