About acetylene;1,5-dimethyl-4-[(Z)-prop-1-enyl]-3H-pyrrol-2-one
acetylene;1,5-dimethyl-4-[(Z)-prop-1-enyl]-3H-pyrrol-2-one (PubChem CID 143469016) has the molecular formula C11H15NO
and a molecular weight of 177.25 g/mol. Its IUPAC name is acetylene;1,5-dimethyl-4-[(Z)-prop-1-enyl]-3H-pyrrol-2-one.
Molecular Properties
| Compound Name | acetylene;1,5-dimethyl-4-[(Z)-prop-1-enyl]-3H-pyrrol-2-one |
| PubChem CID | 143469016 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | acetylene;1,5-dimethyl-4-[(Z)-prop-1-enyl]-3H-pyrrol-2-one |
| SMILES | C#C.C/C=C\C1=C(C)N(C)C(=O)C1 |
| InChI | InChI=1S/C9H13NO.C2H2/c1-4-5-8-6-9(11)10(3)7(8)2;1-2/h4-5H,6H2,1-3H3;1-2H/b5-4-; |
| InChIKey | ARADGATZGNTNCK-MKWAYWHRSA-N |
| XLogP | 1.95 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;1,5-dimethyl-4-[(Z)-prop-1-enyl]-3H-pyrrol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;1,5-dimethyl-4-[(Z)-prop-1-enyl]-3H-pyrrol-2-one?
The IUPAC name of acetylene;1,5-dimethyl-4-[(Z)-prop-1-enyl]-3H-pyrrol-2-one (CID 143469016) is acetylene;1,5-dimethyl-4-[(Z)-prop-1-enyl]-3H-pyrrol-2-one.
What is the SMILES notation for acetylene;1,5-dimethyl-4-[(Z)-prop-1-enyl]-3H-pyrrol-2-one?
The canonical SMILES for acetylene;1,5-dimethyl-4-[(Z)-prop-1-enyl]-3H-pyrrol-2-one is C#C.C/C=C\C1=C(C)N(C)C(=O)C1.
What is the InChIKey of acetylene;1,5-dimethyl-4-[(Z)-prop-1-enyl]-3H-pyrrol-2-one?
The InChIKey is ARADGATZGNTNCK-MKWAYWHRSA-N. The full InChI is InChI=1S/C9H13NO.C2H2/c1-4-5-8-6-9(11)10(3)7(8)2;1-2/h4-5H,6H2,1-3H3;1-2H/b5-4-;.
What are the key properties of acetylene;1,5-dimethyl-4-[(Z)-prop-1-enyl]-3H-pyrrol-2-one?
acetylene;1,5-dimethyl-4-[(Z)-prop-1-enyl]-3H-pyrrol-2-one has a molecular weight of 177.25 g/mol, XLogP of 1.95, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;1,5-dimethyl-4-[(Z)-prop-1-enyl]-3H-pyrrol-2-one is sourced from PubChem (CID 143469016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).