C13H25N5O3 — CID 143469326
3-amino-8-octyl-1,2,4,8-tetrazabicyclo[4.2.0]octa-2,6-dien-5-one;hydroperoxymethane (PubChem CID 143469326) has the molecular formula C13H25N5O3 and a molecular weight of 299.38 g/mol. Its IUPAC name is 3-amino-8-octyl-1,2,4,8-tetrazabicyclo[4.2.0]octa-2,6-dien-5-one;hydroperoxymethane.
| Compound Name | 3-amino-8-octyl-1,2,4,8-tetrazabicyclo[4.2.0]octa-2,6-dien-5-one;hydroperoxymethane |
|---|---|
| PubChem CID | 143469326 |
| Molecular Formula | C13H25N5O3 |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | 3-amino-8-octyl-1,2,4,8-tetrazabicyclo[4.2.0]octa-2,6-dien-5-one;hydroperoxymethane |
| SMILES | CCCCCCCCn1cc2c(=O)[nH]c(N)nn21.COO |
| InChI | InChI=1S/C12H21N5O.CH4O2/c1-2-3-4-5-6-7-8-16-9-10-11(18)14-12(13)15-17(10)16;1-3-2/h9H,2-8H2,1H3,(H3,13,14,15,18);2H,1H3 |
| InChIKey | WWCKGRKEAGLHGH-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|