C27H30N6 — CID 143469524
1-(1H-indol-2-yl)-3-[1-[(2-methylcyclohexa-2,5-dien-1-yl)methyl]piperidin-4-yl]imidazo[1,5-a]pyrazin-8-amine (PubChem CID 143469524) has the molecular formula C27H30N6 and a molecular weight of 438.58 g/mol. Its IUPAC name is 1-(1H-indol-2-yl)-3-[1-[(2-methylcyclohexa-2,5-dien-1-yl)methyl]piperidin-4-yl]imidazo[1,5-a]pyrazin-8-amine.
| Compound Name | 1-(1H-indol-2-yl)-3-[1-[(2-methylcyclohexa-2,5-dien-1-yl)methyl]piperidin-4-yl]imidazo[1,5-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 143469524 |
| Molecular Formula | C27H30N6 |
| Molecular Weight | 438.58 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | 1-(1H-indol-2-yl)-3-[1-[(2-methylcyclohexa-2,5-dien-1-yl)methyl]piperidin-4-yl]imidazo[1,5-a]pyrazin-8-amine |
| SMILES | CC1=CCC=CC1CN1CCC(c2nc(-c3cc4ccccc4[nH]3)c3c(N)nccn23)CC1 |
| InChI | InChI=1S/C27H30N6/c1-18-6-2-3-8-21(18)17-32-13-10-19(11-14-32)27-31-24(25-26(28)29-12-15-33(25)27)23-16-20-7-4-5-9-22(20)30-23/h3-9,12,15-16,19,21,30H,2,10-11,13-14,17H2,1H3,(H2,28,29) |
| InChIKey | JJQVJGHMVQZGOY-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 75.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.58 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|