About 1-[(Z)-but-2-enyl]-1,3,8-triazaspiro[4.5]decan-4-one
1-[(Z)-but-2-enyl]-1,3,8-triazaspiro[4.5]decan-4-one (PubChem CID 143469935) has the molecular formula C11H19N3O
and a molecular weight of 209.29 g/mol. Its IUPAC name is 1-[(Z)-but-2-enyl]-1,3,8-triazaspiro[4.5]decan-4-one.
Molecular Properties
| Compound Name | 1-[(Z)-but-2-enyl]-1,3,8-triazaspiro[4.5]decan-4-one |
| PubChem CID | 143469935 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | 1-[(Z)-but-2-enyl]-1,3,8-triazaspiro[4.5]decan-4-one |
| SMILES | C/C=C\CN1CNC(=O)C12CCNCC2 |
| InChI | InChI=1S/C11H19N3O/c1-2-3-8-14-9-13-10(15)11(14)4-6-12-7-5-11/h2-3,12H,4-9H2,1H3,(H,13,15)/b3-2- |
| InChIKey | RMJCAHVBSICZLR-IHWYPQMZSA-N |
| XLogP | 0.07 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(Z)-but-2-enyl]-1,3,8-triazaspiro[4.5]decan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(Z)-but-2-enyl]-1,3,8-triazaspiro[4.5]decan-4-one?
The IUPAC name of 1-[(Z)-but-2-enyl]-1,3,8-triazaspiro[4.5]decan-4-one (CID 143469935) is 1-[(Z)-but-2-enyl]-1,3,8-triazaspiro[4.5]decan-4-one.
What is the SMILES notation for 1-[(Z)-but-2-enyl]-1,3,8-triazaspiro[4.5]decan-4-one?
The canonical SMILES for 1-[(Z)-but-2-enyl]-1,3,8-triazaspiro[4.5]decan-4-one is C/C=C\CN1CNC(=O)C12CCNCC2.
What is the InChIKey of 1-[(Z)-but-2-enyl]-1,3,8-triazaspiro[4.5]decan-4-one?
The InChIKey is RMJCAHVBSICZLR-IHWYPQMZSA-N. The full InChI is InChI=1S/C11H19N3O/c1-2-3-8-14-9-13-10(15)11(14)4-6-12-7-5-11/h2-3,12H,4-9H2,1H3,(H,13,15)/b3-2-.
What are the key properties of 1-[(Z)-but-2-enyl]-1,3,8-triazaspiro[4.5]decan-4-one?
1-[(Z)-but-2-enyl]-1,3,8-triazaspiro[4.5]decan-4-one has a molecular weight of 209.29 g/mol, XLogP of 0.07, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(Z)-but-2-enyl]-1,3,8-triazaspiro[4.5]decan-4-one is sourced from PubChem (CID 143469935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).