C16H27NO2 — CID 143470750
N-(3-hydroxy-3-phenylpropyl)butanamide;propane (PubChem CID 143470750) has the molecular formula C16H27NO2 and a molecular weight of 265.40 g/mol. Its IUPAC name is N-(3-hydroxy-3-phenylpropyl)butanamide;propane.
| Compound Name | N-(3-hydroxy-3-phenylpropyl)butanamide;propane |
|---|---|
| PubChem CID | 143470750 |
| Molecular Formula | C16H27NO2 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | N-(3-hydroxy-3-phenylpropyl)butanamide;propane |
| SMILES | CCC.CCCC(=O)NCCC(O)c1ccccc1 |
| InChI | InChI=1S/C13H19NO2.C3H8/c1-2-6-13(16)14-10-9-12(15)11-7-4-3-5-8-11;1-3-2/h3-5,7-8,12,15H,2,6,9-10H2,1H3,(H,14,16);3H2,1-2H3 |
| InChIKey | JKDFITTXOOQUON-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |