C26H26FN7OS — CID 143470975
5-fluoro-N-[(E)-[5-(3-methyl-4-thiophen-2-ylanilino)-2-pyridinyl]methylideneamino]-4-(1,4-oxazepan-4-yl)pyrimidin-2-amine (PubChem CID 143470975) has the molecular formula C26H26FN7OS and a molecular weight of 503.61 g/mol. Its IUPAC name is 5-fluoro-N-[(E)-[5-(3-methyl-4-thiophen-2-ylanilino)-2-pyridinyl]methylideneamino]-4-(1,4-oxazepan-4-yl)pyrimidin-2-amine.
| Compound Name | 5-fluoro-N-[(E)-[5-(3-methyl-4-thiophen-2-ylanilino)-2-pyridinyl]methylideneamino]-4-(1,4-oxazepan-4-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 143470975 |
| Molecular Formula | C26H26FN7OS |
| Molecular Weight | 503.61 g/mol |
| Exact Mass | 503.19 |
| IUPAC Name | 5-fluoro-N-[(E)-[5-(3-methyl-4-thiophen-2-ylanilino)-2-pyridinyl]methylideneamino]-4-(1,4-oxazepan-4-yl)pyrimidin-2-amine |
| SMILES | Cc1cc(Nc2ccc(/C=N/Nc3ncc(F)c(N4CCCOCC4)n3)nc2)ccc1-c1cccs1 |
| InChI | InChI=1S/C26H26FN7OS/c1-18-14-19(7-8-22(18)24-4-2-13-36-24)31-21-6-5-20(28-15-21)16-30-33-26-29-17-23(27)25(32-26)34-9-3-11-35-12-10-34/h2,4-8,13-17,31H,3,9-12H2,1H3,(H,29,32,33)/b30-16+ |
| InChIKey | FKSCEFFBQHHZIN-OKCVXOCRSA-N |
| XLogP | 5.46 |
| TPSA | 87.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.61 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|