C27H34ClN9O2 — CID 143471116
2-[4-[3-chloro-5-[[6-[(E)-[(5-methyl-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]-3-pyridinyl]amino]phenyl]piperazin-1-yl]ethanol (PubChem CID 143471116) has the molecular formula C27H34ClN9O2 and a molecular weight of 552.08 g/mol. Its IUPAC name is 2-[4-[3-chloro-5-[[6-[(E)-[(5-methyl-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]-3-pyridinyl]amino]phenyl]piperazin-1-yl]ethanol.
| Compound Name | 2-[4-[3-chloro-5-[[6-[(E)-[(5-methyl-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]-3-pyridinyl]amino]phenyl]piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 143471116 |
| Molecular Formula | C27H34ClN9O2 |
| Molecular Weight | 552.08 g/mol |
| Exact Mass | 551.25 |
| IUPAC Name | 2-[4-[3-chloro-5-[[6-[(E)-[(5-methyl-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]-3-pyridinyl]amino]phenyl]piperazin-1-yl]ethanol |
| SMILES | Cc1cnc(N/N=C/c2ccc(Nc3cc(Cl)cc(N4CCN(CCO)CC4)c3)cn2)nc1N1CCOCC1 |
| InChI | InChI=1S/C27H34ClN9O2/c1-20-17-30-27(33-26(20)37-9-12-39-13-10-37)34-31-19-22-2-3-23(18-29-22)32-24-14-21(28)15-25(16-24)36-6-4-35(5-7-36)8-11-38/h2-3,14-19,32,38H,4-13H2,1H3,(H,30,33,34)/b31-19+ |
| InChIKey | DJPPHZYKJQNBCR-ZCTHSVRISA-N |
| XLogP | 2.97 |
| TPSA | 114.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.08 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|