C25H25ClFN9O — CID 143471132
N-[(E)-[5-[[(2E,4Z)-3-chloro-4-pyrimidin-4-ylhepta-2,4,6-trienyl]amino]-2-pyridinyl]methylideneamino]-5-fluoro-4-morpholin-4-ylpyrimidin-2-amine (PubChem CID 143471132) has the molecular formula C25H25ClFN9O and a molecular weight of 521.99 g/mol. Its IUPAC name is N-[(E)-[5-[[(2E,4Z)-3-chloro-4-pyrimidin-4-ylhepta-2,4,6-trienyl]amino]-2-pyridinyl]methylideneamino]-5-fluoro-4-morpholin-4-ylpyrimidin-2-amine.
| Compound Name | N-[(E)-[5-[[(2E,4Z)-3-chloro-4-pyrimidin-4-ylhepta-2,4,6-trienyl]amino]-2-pyridinyl]methylideneamino]-5-fluoro-4-morpholin-4-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 143471132 |
| Molecular Formula | C25H25ClFN9O |
| Molecular Weight | 521.99 g/mol |
| Exact Mass | 521.19 |
| IUPAC Name | N-[(E)-[5-[[(2E,4Z)-3-chloro-4-pyrimidin-4-ylhepta-2,4,6-trienyl]amino]-2-pyridinyl]methylideneamino]-5-fluoro-4-morpholin-4-ylpyrimidin-2-amine |
| SMILES | C=C/C=C(C(\Cl)=C/CNc1ccc(/C=N/Nc2ncc(F)c(N3CCOCC3)n2)nc1)/c1ccncn1 |
| InChI | InChI=1S/C25H25ClFN9O/c1-2-3-20(23-7-8-28-17-32-23)21(26)6-9-29-18-4-5-19(30-14-18)15-33-35-25-31-16-22(27)24(34-25)36-10-12-37-13-11-36/h2-8,14-17,29H,1,9-13H2,(H,31,34,35)/b20-3+,21-6+,33-15+ |
| InChIKey | NNMWJGXNIZXDGL-KRBAOECNSA-N |
| XLogP | 3.89 |
| TPSA | 113.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.99 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|