C28H28F4N8O2 — CID 143471159
3-[3-[[6-[(E)-[[5-fluoro-4-(2-propoxyethylamino)pyrimidin-2-yl]hydrazinylidene]methyl]-3-pyridinyl]amino]-5-(trifluoromethyl)anilino]phenol (PubChem CID 143471159) has the molecular formula C28H28F4N8O2 and a molecular weight of 584.58 g/mol. Its IUPAC name is 3-[3-[[6-[(E)-[[5-fluoro-4-(2-propoxyethylamino)pyrimidin-2-yl]hydrazinylidene]methyl]-3-pyridinyl]amino]-5-(trifluoromethyl)anilino]phenol.
| Compound Name | 3-[3-[[6-[(E)-[[5-fluoro-4-(2-propoxyethylamino)pyrimidin-2-yl]hydrazinylidene]methyl]-3-pyridinyl]amino]-5-(trifluoromethyl)anilino]phenol |
|---|---|
| PubChem CID | 143471159 |
| Molecular Formula | C28H28F4N8O2 |
| Molecular Weight | 584.58 g/mol |
| Exact Mass | 584.23 |
| IUPAC Name | 3-[3-[[6-[(E)-[[5-fluoro-4-(2-propoxyethylamino)pyrimidin-2-yl]hydrazinylidene]methyl]-3-pyridinyl]amino]-5-(trifluoromethyl)anilino]phenol |
| SMILES | CCCOCCNc1nc(N/N=C/c2ccc(Nc3cc(Nc4cccc(O)c4)cc(C(F)(F)F)c3)cn2)ncc1F |
| InChI | InChI=1S/C28H28F4N8O2/c1-2-9-42-10-8-33-26-25(29)17-35-27(39-26)40-36-16-20-6-7-21(15-34-20)38-23-12-18(28(30,31)32)11-22(13-23)37-19-4-3-5-24(41)14-19/h3-7,11-17,37-38,41H,2,8-10H2,1H3,(H2,33,35,39,40)/b36-16+ |
| InChIKey | QIANDBAHJIOKDQ-ODQASSKESA-N |
| XLogP | 6.51 |
| TPSA | 128.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.58 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|