About 4-(5-fluoropyrimidin-4-yl)morpholine;pyridin-2-ylmethanimine
4-(5-fluoropyrimidin-4-yl)morpholine;pyridin-2-ylmethanimine (PubChem CID 143471171) has the molecular formula C14H16FN5O
and a molecular weight of 289.31 g/mol. Its IUPAC name is 4-(5-fluoropyrimidin-4-yl)morpholine;pyridin-2-ylmethanimine.
Molecular Properties
| Compound Name | 4-(5-fluoropyrimidin-4-yl)morpholine;pyridin-2-ylmethanimine |
| PubChem CID | 143471171 |
| Molecular Formula | C14H16FN5O |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 4-(5-fluoropyrimidin-4-yl)morpholine;pyridin-2-ylmethanimine |
| SMILES | Fc1cncnc1N1CCOCC1.[H]/N=C/c1ccccn1 |
| InChI | InChI=1S/C8H10FN3O.C6H6N2/c9-7-5-10-6-11-8(7)12-1-3-13-4-2-12;7-5-6-3-1-2-4-8-6/h5-6H,1-4H2;1-5,7H/b;7-5+ |
| InChIKey | BUVHQQNPGSTRPO-QIHXQYKCSA-N |
| XLogP | 1.53 |
| TPSA | 74.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(5-fluoropyrimidin-4-yl)morpholine;pyridin-2-ylmethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-fluoropyrimidin-4-yl)morpholine;pyridin-2-ylmethanimine?
The IUPAC name of 4-(5-fluoropyrimidin-4-yl)morpholine;pyridin-2-ylmethanimine (CID 143471171) is 4-(5-fluoropyrimidin-4-yl)morpholine;pyridin-2-ylmethanimine.
What is the SMILES notation for 4-(5-fluoropyrimidin-4-yl)morpholine;pyridin-2-ylmethanimine?
The canonical SMILES for 4-(5-fluoropyrimidin-4-yl)morpholine;pyridin-2-ylmethanimine is Fc1cncnc1N1CCOCC1.[H]/N=C/c1ccccn1.
What is the InChIKey of 4-(5-fluoropyrimidin-4-yl)morpholine;pyridin-2-ylmethanimine?
The InChIKey is BUVHQQNPGSTRPO-QIHXQYKCSA-N. The full InChI is InChI=1S/C8H10FN3O.C6H6N2/c9-7-5-10-6-11-8(7)12-1-3-13-4-2-12;7-5-6-3-1-2-4-8-6/h5-6H,1-4H2;1-5,7H/b;7-5+.
What are the key properties of 4-(5-fluoropyrimidin-4-yl)morpholine;pyridin-2-ylmethanimine?
4-(5-fluoropyrimidin-4-yl)morpholine;pyridin-2-ylmethanimine has a molecular weight of 289.31 g/mol, XLogP of 1.53, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-fluoropyrimidin-4-yl)morpholine;pyridin-2-ylmethanimine is sourced from PubChem (CID 143471171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).