About [cyclohexa-2,4-dien-1-yl(phenyl)methyl] carbamimidothioate
[cyclohexa-2,4-dien-1-yl(phenyl)methyl] carbamimidothioate (PubChem CID 143471413) has the molecular formula C14H16N2S
and a molecular weight of 244.36 g/mol. Its IUPAC name is [cyclohexa-2,4-dien-1-yl(phenyl)methyl] carbamimidothioate.
Molecular Properties
| Compound Name | [cyclohexa-2,4-dien-1-yl(phenyl)methyl] carbamimidothioate |
| PubChem CID | 143471413 |
| Molecular Formula | C14H16N2S |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | [cyclohexa-2,4-dien-1-yl(phenyl)methyl] carbamimidothioate |
| SMILES | [H]/N=C(\N)SC(c1ccccc1)C1C=CC=CC1 |
| InChI | InChI=1S/C14H16N2S/c15-14(16)17-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-9,12-13H,10H2,(H3,15,16) |
| InChIKey | OCBBHGJBWGFPSH-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze [cyclohexa-2,4-dien-1-yl(phenyl)methyl] carbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [cyclohexa-2,4-dien-1-yl(phenyl)methyl] carbamimidothioate?
The IUPAC name of [cyclohexa-2,4-dien-1-yl(phenyl)methyl] carbamimidothioate (CID 143471413) is [cyclohexa-2,4-dien-1-yl(phenyl)methyl] carbamimidothioate.
What is the SMILES notation for [cyclohexa-2,4-dien-1-yl(phenyl)methyl] carbamimidothioate?
The canonical SMILES for [cyclohexa-2,4-dien-1-yl(phenyl)methyl] carbamimidothioate is [H]/N=C(\N)SC(c1ccccc1)C1C=CC=CC1.
What is the InChIKey of [cyclohexa-2,4-dien-1-yl(phenyl)methyl] carbamimidothioate?
The InChIKey is OCBBHGJBWGFPSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2S/c15-14(16)17-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-9,12-13H,10H2,(H3,15,16).
What are the key properties of [cyclohexa-2,4-dien-1-yl(phenyl)methyl] carbamimidothioate?
[cyclohexa-2,4-dien-1-yl(phenyl)methyl] carbamimidothioate has a molecular weight of 244.36 g/mol, XLogP of 3.49, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [cyclohexa-2,4-dien-1-yl(phenyl)methyl] carbamimidothioate is sourced from PubChem (CID 143471413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).