C21H14F6O — CID 143471848
1-fluoro-3-[(4-fluorophenyl)-phenylmethyl]-5-(1,1,2,2-tetrafluoroethoxy)benzene (PubChem CID 143471848) has the molecular formula C21H14F6O and a molecular weight of 396.33 g/mol. Its IUPAC name is 1-fluoro-3-[(4-fluorophenyl)-phenylmethyl]-5-(1,1,2,2-tetrafluoroethoxy)benzene.
| Compound Name | 1-fluoro-3-[(4-fluorophenyl)-phenylmethyl]-5-(1,1,2,2-tetrafluoroethoxy)benzene |
|---|---|
| PubChem CID | 143471848 |
| Molecular Formula | C21H14F6O |
| Molecular Weight | 396.33 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | 1-fluoro-3-[(4-fluorophenyl)-phenylmethyl]-5-(1,1,2,2-tetrafluoroethoxy)benzene |
| SMILES | Fc1ccc(C(c2ccccc2)c2cc(F)cc(OC(F)(F)C(F)F)c2)cc1 |
| InChI | InChI=1S/C21H14F6O/c22-16-8-6-14(7-9-16)19(13-4-2-1-3-5-13)15-10-17(23)12-18(11-15)28-21(26,27)20(24)25/h1-12,19-20H |
| InChIKey | VRSNXINRMBKNIP-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.33 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|