C33H33F10NO3 — CID 143472316
1-fluoro-3-[1-(4-fluoro-3-methoxyphenyl)ethyl]-5-(1,1,2,2-tetrafluoroethoxy)benzene;4-fluoro-3-(trifluoromethyl)benzamide;(2Z,4Z)-6-methylhepta-2,4-diene (PubChem CID 143472316) has the molecular formula C33H33F10NO3 and a molecular weight of 681.61 g/mol. Its IUPAC name is 1-fluoro-3-[1-(4-fluoro-3-methoxyphenyl)ethyl]-5-(1,1,2,2-tetrafluoroethoxy)benzene;4-fluoro-3-(trifluoromethyl)benzamide;(2Z,4Z)-6-methylhepta-2,4-diene.
| Compound Name | 1-fluoro-3-[1-(4-fluoro-3-methoxyphenyl)ethyl]-5-(1,1,2,2-tetrafluoroethoxy)benzene;4-fluoro-3-(trifluoromethyl)benzamide;(2Z,4Z)-6-methylhepta-2,4-diene |
|---|---|
| PubChem CID | 143472316 |
| Molecular Formula | C33H33F10NO3 |
| Molecular Weight | 681.61 g/mol |
| Exact Mass | 681.23 |
| IUPAC Name | 1-fluoro-3-[1-(4-fluoro-3-methoxyphenyl)ethyl]-5-(1,1,2,2-tetrafluoroethoxy)benzene;4-fluoro-3-(trifluoromethyl)benzamide;(2Z,4Z)-6-methylhepta-2,4-diene |
| SMILES | C/C=C\C=C/C(C)C.COc1cc(C(C)c2cc(F)cc(OC(F)(F)C(F)F)c2)ccc1F.NC(=O)c1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H14F6O2.C8H5F4NO.C8H14/c1-9(10-3-4-14(19)15(7-10)24-2)11-5-12(18)8-13(6-11)25-17(22,23)16(20)21;9-6-2-1-4(7(13)14)3-5(6)8(10,11)12;1-4-5-6-7-8(2)3/h3-9,16H,1-2H3;1-3H,(H2,13,14);4-8H,1-3H3/b;;5-4-,7-6- |
| InChIKey | WWRXVUQDQZYNSC-ZSCZZYJVSA-N |
| XLogP | 10.08 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.61 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|