C27H34 — CID 143472595
2-[(4E,5Z)-2-(3,5-dimethylphenyl)-4-propylideneocta-5,7-dien-3-yl]-5-methylcyclohepta-1,3,5-triene (PubChem CID 143472595) has the molecular formula C27H34 and a molecular weight of 358.57 g/mol. Its IUPAC name is 2-[(4E,5Z)-2-(3,5-dimethylphenyl)-4-propylideneocta-5,7-dien-3-yl]-5-methylcyclohepta-1,3,5-triene.
| Compound Name | 2-[(4E,5Z)-2-(3,5-dimethylphenyl)-4-propylideneocta-5,7-dien-3-yl]-5-methylcyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 143472595 |
| Molecular Formula | C27H34 |
| Molecular Weight | 358.57 g/mol |
| Exact Mass | 358.27 |
| IUPAC Name | 2-[(4E,5Z)-2-(3,5-dimethylphenyl)-4-propylideneocta-5,7-dien-3-yl]-5-methylcyclohepta-1,3,5-triene |
| SMILES | C=C/C=C\C(=C/CC)C(C1=CCC=C(C)C=C1)C(C)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C27H34/c1-7-9-13-24(11-8-2)27(25-14-10-12-20(3)15-16-25)23(6)26-18-21(4)17-22(5)19-26/h7,9,11-19,23,27H,1,8,10H2,2-6H3/b13-9-,24-11+ |
| InChIKey | NRMCBIGPZBPOTJ-YIVITMFKSA-N |
| XLogP | 7.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.57 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|