C35H31F7N2O2 — CID 143472607
1-(3-fluorocyclobutyl)-3-[(R)-[4-fluoro-3-[(E)-2-phenylethenyl]phenyl]-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]urea;toluene (PubChem CID 143472607) has the molecular formula C35H31F7N2O2 and a molecular weight of 644.63 g/mol. Its IUPAC name is 1-(3-fluorocyclobutyl)-3-[(R)-[4-fluoro-3-[(E)-2-phenylethenyl]phenyl]-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]urea;toluene.
| Compound Name | 1-(3-fluorocyclobutyl)-3-[(R)-[4-fluoro-3-[(E)-2-phenylethenyl]phenyl]-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]urea;toluene |
|---|---|
| PubChem CID | 143472607 |
| Molecular Formula | C35H31F7N2O2 |
| Molecular Weight | 644.63 g/mol |
| Exact Mass | 644.23 |
| IUPAC Name | 1-(3-fluorocyclobutyl)-3-[(R)-[4-fluoro-3-[(E)-2-phenylethenyl]phenyl]-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]urea;toluene |
| SMILES | Cc1ccccc1.O=C(NC1CC(F)C1)N[C@@H](c1cc(F)cc(OC(F)(F)C(F)F)c1)c1ccc(F)c(/C=C/c2ccccc2)c1 |
| InChI | InChI=1S/C28H23F7N2O2.C7H8/c29-20-11-19(12-23(15-20)39-28(34,35)26(32)33)25(37-27(38)36-22-13-21(30)14-22)18-8-9-24(31)17(10-18)7-6-16-4-2-1-3-5-16;1-7-5-3-2-4-6-7/h1-12,15,21-22,25-26H,13-14H2,(H2,36,37,38);2-6H,1H3/b7-6+;/t21?,22?,25-;/m1./s1 |
| InChIKey | OVZLHJLDLDZCJT-UPGPJTCYSA-N |
| XLogP | 9.26 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.63 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|