C18H27FO3S2 — CID 143472698
methyl 5-[2-fluoro-5-(4-methylsulfanylbutylsulfanylmethyl)phenoxy]pentanoate (PubChem CID 143472698) has the molecular formula C18H27FO3S2 and a molecular weight of 374.54 g/mol. Its IUPAC name is methyl 5-[2-fluoro-5-(4-methylsulfanylbutylsulfanylmethyl)phenoxy]pentanoate.
| Compound Name | methyl 5-[2-fluoro-5-(4-methylsulfanylbutylsulfanylmethyl)phenoxy]pentanoate |
|---|---|
| PubChem CID | 143472698 |
| Molecular Formula | C18H27FO3S2 |
| Molecular Weight | 374.54 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | methyl 5-[2-fluoro-5-(4-methylsulfanylbutylsulfanylmethyl)phenoxy]pentanoate |
| SMILES | COC(=O)CCCCOc1cc(CSCCCCSC)ccc1F |
| InChI | InChI=1S/C18H27FO3S2/c1-21-18(20)7-3-4-10-22-17-13-15(8-9-16(17)19)14-24-12-6-5-11-23-2/h8-9,13H,3-7,10-12,14H2,1-2H3 |
| InChIKey | BRNNYGMPYJXFBQ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.54 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|