About (3E)-N-[(E)-2-chlorobut-1-enyl]hexa-3,5-dien-2-imine
(3E)-N-[(E)-2-chlorobut-1-enyl]hexa-3,5-dien-2-imine (PubChem CID 143473223) has the molecular formula C10H14ClN
and a molecular weight of 183.68 g/mol. Its IUPAC name is (3E)-N-[(E)-2-chlorobut-1-enyl]hexa-3,5-dien-2-imine.
Molecular Properties
| Compound Name | (3E)-N-[(E)-2-chlorobut-1-enyl]hexa-3,5-dien-2-imine |
| PubChem CID | 143473223 |
| Molecular Formula | C10H14ClN |
| Molecular Weight | 183.68 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | (3E)-N-[(E)-2-chlorobut-1-enyl]hexa-3,5-dien-2-imine |
| SMILES | C=C/C=C/C(C)=N/C=C(/Cl)CC |
| InChI | InChI=1S/C10H14ClN/c1-4-6-7-9(3)12-8-10(11)5-2/h4,6-8H,1,5H2,2-3H3/b7-6+,10-8+,12-9+ |
| InChIKey | RVTFGZRZJKRLGZ-WRGRCINPSA-N |
| XLogP | 3.68 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.68 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-N-[(E)-2-chlorobut-1-enyl]hexa-3,5-dien-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-N-[(E)-2-chlorobut-1-enyl]hexa-3,5-dien-2-imine?
The IUPAC name of (3E)-N-[(E)-2-chlorobut-1-enyl]hexa-3,5-dien-2-imine (CID 143473223) is (3E)-N-[(E)-2-chlorobut-1-enyl]hexa-3,5-dien-2-imine.
What is the SMILES notation for (3E)-N-[(E)-2-chlorobut-1-enyl]hexa-3,5-dien-2-imine?
The canonical SMILES for (3E)-N-[(E)-2-chlorobut-1-enyl]hexa-3,5-dien-2-imine is C=C/C=C/C(C)=N/C=C(/Cl)CC.
What is the InChIKey of (3E)-N-[(E)-2-chlorobut-1-enyl]hexa-3,5-dien-2-imine?
The InChIKey is RVTFGZRZJKRLGZ-WRGRCINPSA-N. The full InChI is InChI=1S/C10H14ClN/c1-4-6-7-9(3)12-8-10(11)5-2/h4,6-8H,1,5H2,2-3H3/b7-6+,10-8+,12-9+.
What are the key properties of (3E)-N-[(E)-2-chlorobut-1-enyl]hexa-3,5-dien-2-imine?
(3E)-N-[(E)-2-chlorobut-1-enyl]hexa-3,5-dien-2-imine has a molecular weight of 183.68 g/mol, XLogP of 3.68, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-N-[(E)-2-chlorobut-1-enyl]hexa-3,5-dien-2-imine is sourced from PubChem (CID 143473223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).