About (2R)-3-ethenylhexan-2-amine;methoxyethane
(2R)-3-ethenylhexan-2-amine;methoxyethane (PubChem CID 143473258) has the molecular formula C11H25NO
and a molecular weight of 187.33 g/mol. Its IUPAC name is (2R)-3-ethenylhexan-2-amine;methoxyethane.
Molecular Properties
| Compound Name | (2R)-3-ethenylhexan-2-amine;methoxyethane |
| PubChem CID | 143473258 |
| Molecular Formula | C11H25NO |
| Molecular Weight | 187.33 g/mol |
| Exact Mass | 187.19 |
| IUPAC Name | (2R)-3-ethenylhexan-2-amine;methoxyethane |
| SMILES | C=CC(CCC)[C@@H](C)N.CCOC |
| InChI | InChI=1S/C8H17N.C3H8O/c1-4-6-8(5-2)7(3)9;1-3-4-2/h5,7-8H,2,4,6,9H2,1,3H3;3H2,1-2H3/t7-,8?;/m1./s1 |
| InChIKey | PFMAUXFEPTWPLS-PGMKYVDRSA-N |
| XLogP | 2.59 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.33 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2R)-3-ethenylhexan-2-amine;methoxyethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-3-ethenylhexan-2-amine;methoxyethane?
The IUPAC name of (2R)-3-ethenylhexan-2-amine;methoxyethane (CID 143473258) is (2R)-3-ethenylhexan-2-amine;methoxyethane.
What is the SMILES notation for (2R)-3-ethenylhexan-2-amine;methoxyethane?
The canonical SMILES for (2R)-3-ethenylhexan-2-amine;methoxyethane is C=CC(CCC)[C@@H](C)N.CCOC.
What is the InChIKey of (2R)-3-ethenylhexan-2-amine;methoxyethane?
The InChIKey is PFMAUXFEPTWPLS-PGMKYVDRSA-N. The full InChI is InChI=1S/C8H17N.C3H8O/c1-4-6-8(5-2)7(3)9;1-3-4-2/h5,7-8H,2,4,6,9H2,1,3H3;3H2,1-2H3/t7-,8?;/m1./s1.
What are the key properties of (2R)-3-ethenylhexan-2-amine;methoxyethane?
(2R)-3-ethenylhexan-2-amine;methoxyethane has a molecular weight of 187.33 g/mol, XLogP of 2.59, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-3-ethenylhexan-2-amine;methoxyethane is sourced from PubChem (CID 143473258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).