C26H24F2N2O — CID 14347332
(2E)-5,5-bis(4-fluorophenyl)-N-(4-pyridin-3-ylbutyl)penta-2,4-dienamide (PubChem CID 14347332) has the molecular formula C26H24F2N2O and a molecular weight of 418.49 g/mol. Its IUPAC name is (2E)-5,5-bis(4-fluorophenyl)-N-(4-pyridin-3-ylbutyl)penta-2,4-dienamide.
| Compound Name | (2E)-5,5-bis(4-fluorophenyl)-N-(4-pyridin-3-ylbutyl)penta-2,4-dienamide |
|---|---|
| PubChem CID | 14347332 |
| Molecular Formula | C26H24F2N2O |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | (2E)-5,5-bis(4-fluorophenyl)-N-(4-pyridin-3-ylbutyl)penta-2,4-dienamide |
| SMILES | O=C(/C=C/C=C(c1ccc(F)cc1)c1ccc(F)cc1)NCCCCc1cccnc1 |
| InChI | InChI=1S/C26H24F2N2O/c27-23-13-9-21(10-14-23)25(22-11-15-24(28)16-12-22)7-3-8-26(31)30-18-2-1-5-20-6-4-17-29-19-20/h3-4,6-17,19H,1-2,5,18H2,(H,30,31)/b8-3+ |
| InChIKey | LAUSVRPTAXRLJF-FPYGCLRLSA-N |
| XLogP | 5.49 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|