C10H16ClFN2 — CID 143473476
1-N'-[(3Z,5Z)-6-chloro-5-fluorohepta-3,5-dien-2-yl]-1-N-methylethene-1,1-diamine (PubChem CID 143473476) has the molecular formula C10H16ClFN2 and a molecular weight of 218.70 g/mol. Its IUPAC name is 1-N'-[(3Z,5Z)-6-chloro-5-fluorohepta-3,5-dien-2-yl]-1-N-methylethene-1,1-diamine.
| Compound Name | 1-N'-[(3Z,5Z)-6-chloro-5-fluorohepta-3,5-dien-2-yl]-1-N-methylethene-1,1-diamine |
|---|---|
| PubChem CID | 143473476 |
| Molecular Formula | C10H16ClFN2 |
| Molecular Weight | 218.70 g/mol |
| Exact Mass | 218.10 |
| IUPAC Name | 1-N'-[(3Z,5Z)-6-chloro-5-fluorohepta-3,5-dien-2-yl]-1-N-methylethene-1,1-diamine |
| SMILES | C=C(NC)NC(C)/C=C\C(F)=C(/C)Cl |
| InChI | InChI=1S/C10H16ClFN2/c1-7(14-9(3)13-4)5-6-10(12)8(2)11/h5-7,13-14H,3H2,1-2,4H3/b6-5-,10-8- |
| InChIKey | UHXCJSXAZCTGBN-XUTLIFGGSA-N |
| XLogP | 2.65 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.70 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|