C27H26F2N2O — CID 14347348
(2E)-5,5-bis(3-fluorophenyl)-N-[(2R)-5-pyridin-3-ylpentan-2-yl]penta-2,4-dienamide (PubChem CID 14347348) has the molecular formula C27H26F2N2O and a molecular weight of 432.51 g/mol. Its IUPAC name is (2E)-5,5-bis(3-fluorophenyl)-N-[(2R)-5-pyridin-3-ylpentan-2-yl]penta-2,4-dienamide.
| Compound Name | (2E)-5,5-bis(3-fluorophenyl)-N-[(2R)-5-pyridin-3-ylpentan-2-yl]penta-2,4-dienamide |
|---|---|
| PubChem CID | 14347348 |
| Molecular Formula | C27H26F2N2O |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | (2E)-5,5-bis(3-fluorophenyl)-N-[(2R)-5-pyridin-3-ylpentan-2-yl]penta-2,4-dienamide |
| SMILES | C[C@H](CCCc1cccnc1)NC(=O)/C=C/C=C(c1cccc(F)c1)c1cccc(F)c1 |
| InChI | InChI=1S/C27H26F2N2O/c1-20(7-2-8-21-9-6-16-30-19-21)31-27(32)15-5-14-26(22-10-3-12-24(28)17-22)23-11-4-13-25(29)18-23/h3-6,9-20H,2,7-8H2,1H3,(H,31,32)/b15-5+/t20-/m1/s1 |
| InChIKey | ACLSUALHMZIIAQ-NINHTKBVSA-N |
| XLogP | 5.88 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|