C29H32N2O3 — CID 14347357
(2E)-5,5-bis(4-methoxyphenyl)-N-[(2R)-5-pyridin-3-ylpentan-2-yl]penta-2,4-dienamide (PubChem CID 14347357) has the molecular formula C29H32N2O3 and a molecular weight of 456.59 g/mol. Its IUPAC name is (2E)-5,5-bis(4-methoxyphenyl)-N-[(2R)-5-pyridin-3-ylpentan-2-yl]penta-2,4-dienamide.
| Compound Name | (2E)-5,5-bis(4-methoxyphenyl)-N-[(2R)-5-pyridin-3-ylpentan-2-yl]penta-2,4-dienamide |
|---|---|
| PubChem CID | 14347357 |
| Molecular Formula | C29H32N2O3 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | (2E)-5,5-bis(4-methoxyphenyl)-N-[(2R)-5-pyridin-3-ylpentan-2-yl]penta-2,4-dienamide |
| SMILES | COc1ccc(C(=C/C=C/C(=O)N[C@H](C)CCCc2cccnc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C29H32N2O3/c1-22(7-4-8-23-9-6-20-30-21-23)31-29(32)11-5-10-28(24-12-16-26(33-2)17-13-24)25-14-18-27(34-3)19-15-25/h5-6,9-22H,4,7-8H2,1-3H3,(H,31,32)/b11-5+/t22-/m1/s1 |
| InChIKey | PSJXTUCCJLEFFC-NCZOVAKNSA-N |
| XLogP | 5.61 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|