C31H36N2O5 — CID 14347360
(2E)-5,5-bis(3,4-dimethoxyphenyl)-N-[(2R)-5-pyridin-3-ylpentan-2-yl]penta-2,4-dienamide (PubChem CID 14347360) has the molecular formula C31H36N2O5 and a molecular weight of 516.64 g/mol. Its IUPAC name is (2E)-5,5-bis(3,4-dimethoxyphenyl)-N-[(2R)-5-pyridin-3-ylpentan-2-yl]penta-2,4-dienamide.
| Compound Name | (2E)-5,5-bis(3,4-dimethoxyphenyl)-N-[(2R)-5-pyridin-3-ylpentan-2-yl]penta-2,4-dienamide |
|---|---|
| PubChem CID | 14347360 |
| Molecular Formula | C31H36N2O5 |
| Molecular Weight | 516.64 g/mol |
| Exact Mass | 516.26 |
| IUPAC Name | (2E)-5,5-bis(3,4-dimethoxyphenyl)-N-[(2R)-5-pyridin-3-ylpentan-2-yl]penta-2,4-dienamide |
| SMILES | COc1ccc(C(=C/C=C/C(=O)N[C@H](C)CCCc2cccnc2)c2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C31H36N2O5/c1-22(9-6-10-23-11-8-18-32-21-23)33-31(34)13-7-12-26(24-14-16-27(35-2)29(19-24)37-4)25-15-17-28(36-3)30(20-25)38-5/h7-8,11-22H,6,9-10H2,1-5H3,(H,33,34)/b13-7+/t22-/m1/s1 |
| InChIKey | KYAGZPGUYGDWKP-ZCQBWMKESA-N |
| XLogP | 5.63 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.64 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|