C27H27FN2O2 — CID 14347367
(2E,4E)-5-(3-fluorophenyl)-5-(3-methoxyphenyl)-N-(4-pyridin-3-ylbutyl)penta-2,4-dienamide (PubChem CID 14347367) has the molecular formula C27H27FN2O2 and a molecular weight of 430.52 g/mol. Its IUPAC name is (2E,4E)-5-(3-fluorophenyl)-5-(3-methoxyphenyl)-N-(4-pyridin-3-ylbutyl)penta-2,4-dienamide.
| Compound Name | (2E,4E)-5-(3-fluorophenyl)-5-(3-methoxyphenyl)-N-(4-pyridin-3-ylbutyl)penta-2,4-dienamide |
|---|---|
| PubChem CID | 14347367 |
| Molecular Formula | C27H27FN2O2 |
| Molecular Weight | 430.52 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | (2E,4E)-5-(3-fluorophenyl)-5-(3-methoxyphenyl)-N-(4-pyridin-3-ylbutyl)penta-2,4-dienamide |
| SMILES | COc1cccc(/C(=C\C=C\C(=O)NCCCCc2cccnc2)c2cccc(F)c2)c1 |
| InChI | InChI=1S/C27H27FN2O2/c1-32-25-13-5-11-23(19-25)26(22-10-4-12-24(28)18-22)14-6-15-27(31)30-17-3-2-8-21-9-7-16-29-20-21/h4-7,9-16,18-20H,2-3,8,17H2,1H3,(H,30,31)/b15-6+,26-14- |
| InChIKey | YTWAHMJSTIPNPF-TZDGRNIHSA-N |
| XLogP | 5.36 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.52 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|