C27H28N2O4 — CID 14347373
(2E)-5,5-bis(4-methoxyphenyl)-N-(3-pyridin-3-yloxypropyl)penta-2,4-dienamide (PubChem CID 14347373) has the molecular formula C27H28N2O4 and a molecular weight of 444.53 g/mol. Its IUPAC name is (2E)-5,5-bis(4-methoxyphenyl)-N-(3-pyridin-3-yloxypropyl)penta-2,4-dienamide.
| Compound Name | (2E)-5,5-bis(4-methoxyphenyl)-N-(3-pyridin-3-yloxypropyl)penta-2,4-dienamide |
|---|---|
| PubChem CID | 14347373 |
| Molecular Formula | C27H28N2O4 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | (2E)-5,5-bis(4-methoxyphenyl)-N-(3-pyridin-3-yloxypropyl)penta-2,4-dienamide |
| SMILES | COc1ccc(C(=C/C=C/C(=O)NCCCOc2cccnc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C27H28N2O4/c1-31-23-13-9-21(10-14-23)26(22-11-15-24(32-2)16-12-22)7-3-8-27(30)29-18-5-19-33-25-6-4-17-28-20-25/h3-4,6-17,20H,5,18-19H2,1-2H3,(H,29,30)/b8-3+ |
| InChIKey | WDOONJQSKBLQAF-FPYGCLRLSA-N |
| XLogP | 4.67 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|