About (2S)-4,4-difluoro-1-methylpyrrolidine-2-carbonitrile;ethane
(2S)-4,4-difluoro-1-methylpyrrolidine-2-carbonitrile;ethane (PubChem CID 143473733) has the molecular formula C8H14F2N2
and a molecular weight of 176.21 g/mol. Its IUPAC name is (2S)-4,4-difluoro-1-methylpyrrolidine-2-carbonitrile;ethane.
Molecular Properties
| Compound Name | (2S)-4,4-difluoro-1-methylpyrrolidine-2-carbonitrile;ethane |
| PubChem CID | 143473733 |
| Molecular Formula | C8H14F2N2 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.11 |
| IUPAC Name | (2S)-4,4-difluoro-1-methylpyrrolidine-2-carbonitrile;ethane |
| SMILES | CC.CN1CC(F)(F)C[C@H]1C#N |
| InChI | InChI=1S/C6H8F2N2.C2H6/c1-10-4-6(7,8)2-5(10)3-9;1-2/h5H,2,4H2,1H3;1-2H3/t5-;/m0./s1 |
| InChIKey | JAAFFTFCLBTKAU-JEDNCBNOSA-N |
| XLogP | 1.88 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-4,4-difluoro-1-methylpyrrolidine-2-carbonitrile;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-4,4-difluoro-1-methylpyrrolidine-2-carbonitrile;ethane?
The IUPAC name of (2S)-4,4-difluoro-1-methylpyrrolidine-2-carbonitrile;ethane (CID 143473733) is (2S)-4,4-difluoro-1-methylpyrrolidine-2-carbonitrile;ethane.
What is the SMILES notation for (2S)-4,4-difluoro-1-methylpyrrolidine-2-carbonitrile;ethane?
The canonical SMILES for (2S)-4,4-difluoro-1-methylpyrrolidine-2-carbonitrile;ethane is CC.CN1CC(F)(F)C[C@H]1C#N.
What is the InChIKey of (2S)-4,4-difluoro-1-methylpyrrolidine-2-carbonitrile;ethane?
The InChIKey is JAAFFTFCLBTKAU-JEDNCBNOSA-N. The full InChI is InChI=1S/C6H8F2N2.C2H6/c1-10-4-6(7,8)2-5(10)3-9;1-2/h5H,2,4H2,1H3;1-2H3/t5-;/m0./s1.
What are the key properties of (2S)-4,4-difluoro-1-methylpyrrolidine-2-carbonitrile;ethane?
(2S)-4,4-difluoro-1-methylpyrrolidine-2-carbonitrile;ethane has a molecular weight of 176.21 g/mol, XLogP of 1.88, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-4,4-difluoro-1-methylpyrrolidine-2-carbonitrile;ethane is sourced from PubChem (CID 143473733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).