About 1-hydroxypropan-2-ylurea;1,1,1-trifluoroethane
1-hydroxypropan-2-ylurea;1,1,1-trifluoroethane (PubChem CID 143473747) has the molecular formula C6H13F3N2O2
and a molecular weight of 202.18 g/mol. Its IUPAC name is 1-hydroxypropan-2-ylurea;1,1,1-trifluoroethane.
Molecular Properties
| Compound Name | 1-hydroxypropan-2-ylurea;1,1,1-trifluoroethane |
| PubChem CID | 143473747 |
| Molecular Formula | C6H13F3N2O2 |
| Molecular Weight | 202.18 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | 1-hydroxypropan-2-ylurea;1,1,1-trifluoroethane |
| SMILES | CC(CO)NC(N)=O.CC(F)(F)F |
| InChI | InChI=1S/C4H10N2O2.C2H3F3/c1-3(2-7)6-4(5)8;1-2(3,4)5/h3,7H,2H2,1H3,(H3,5,6,8);1H3 |
| InChIKey | URCJOYNGZLGEIO-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.18 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-hydroxypropan-2-ylurea;1,1,1-trifluoroethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxypropan-2-ylurea;1,1,1-trifluoroethane?
The IUPAC name of 1-hydroxypropan-2-ylurea;1,1,1-trifluoroethane (CID 143473747) is 1-hydroxypropan-2-ylurea;1,1,1-trifluoroethane.
What is the SMILES notation for 1-hydroxypropan-2-ylurea;1,1,1-trifluoroethane?
The canonical SMILES for 1-hydroxypropan-2-ylurea;1,1,1-trifluoroethane is CC(CO)NC(N)=O.CC(F)(F)F.
What is the InChIKey of 1-hydroxypropan-2-ylurea;1,1,1-trifluoroethane?
The InChIKey is URCJOYNGZLGEIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N2O2.C2H3F3/c1-3(2-7)6-4(5)8;1-2(3,4)5/h3,7H,2H2,1H3,(H3,5,6,8);1H3.
What are the key properties of 1-hydroxypropan-2-ylurea;1,1,1-trifluoroethane?
1-hydroxypropan-2-ylurea;1,1,1-trifluoroethane has a molecular weight of 202.18 g/mol, XLogP of 0.60, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxypropan-2-ylurea;1,1,1-trifluoroethane is sourced from PubChem (CID 143473747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).