C30H30ClF2N3S — CID 143473799
3-chloro-5-[[[1-[3-(1,1-difluoroethyl)phenyl]-1-(5-methyl-2-pyridinyl)-2-phenylethyl]amino]-dimethylidene-λ6-sulfanyl]aniline (PubChem CID 143473799) has the molecular formula C30H30ClF2N3S and a molecular weight of 538.11 g/mol. Its IUPAC name is 3-chloro-5-[[[1-[3-(1,1-difluoroethyl)phenyl]-1-(5-methyl-2-pyridinyl)-2-phenylethyl]amino]-dimethylidene-λ6-sulfanyl]aniline.
| Compound Name | 3-chloro-5-[[[1-[3-(1,1-difluoroethyl)phenyl]-1-(5-methyl-2-pyridinyl)-2-phenylethyl]amino]-dimethylidene-λ6-sulfanyl]aniline |
|---|---|
| PubChem CID | 143473799 |
| Molecular Formula | C30H30ClF2N3S |
| Molecular Weight | 538.11 g/mol |
| Exact Mass | 537.18 |
| IUPAC Name | 3-chloro-5-[[[1-[3-(1,1-difluoroethyl)phenyl]-1-(5-methyl-2-pyridinyl)-2-phenylethyl]amino]-dimethylidene-λ6-sulfanyl]aniline |
| SMILES | C=S(=C)(NC(Cc1ccccc1)(c1cccc(C(C)(F)F)c1)c1ccc(C)cn1)c1cc(N)cc(Cl)c1 |
| InChI | InChI=1S/C30H30ClF2N3S/c1-21-13-14-28(35-20-21)30(19-22-9-6-5-7-10-22,24-12-8-11-23(15-24)29(2,32)33)36-37(3,4)27-17-25(31)16-26(34)18-27/h5-18,20,36H,3-4,19,34H2,1-2H3 |
| InChIKey | QFARCHYUPNAVKW-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.11 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|