C23H28N2O2 — CID 14347405
(2E,4E)-5-(4-methoxyphenyl)-N-[(2R)-5-pyridin-3-ylpentan-2-yl]hexa-2,4-dienamide (PubChem CID 14347405) has the molecular formula C23H28N2O2 and a molecular weight of 364.49 g/mol. Its IUPAC name is (2E,4E)-5-(4-methoxyphenyl)-N-[(2R)-5-pyridin-3-ylpentan-2-yl]hexa-2,4-dienamide.
| Compound Name | (2E,4E)-5-(4-methoxyphenyl)-N-[(2R)-5-pyridin-3-ylpentan-2-yl]hexa-2,4-dienamide |
|---|---|
| PubChem CID | 14347405 |
| Molecular Formula | C23H28N2O2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | (2E,4E)-5-(4-methoxyphenyl)-N-[(2R)-5-pyridin-3-ylpentan-2-yl]hexa-2,4-dienamide |
| SMILES | COc1ccc(/C(C)=C/C=C/C(=O)N[C@H](C)CCCc2cccnc2)cc1 |
| InChI | InChI=1S/C23H28N2O2/c1-18(21-12-14-22(27-3)15-13-21)7-4-11-23(26)25-19(2)8-5-9-20-10-6-16-24-17-20/h4,6-7,10-17,19H,5,8-9H2,1-3H3,(H,25,26)/b11-4+,18-7+/t19-/m1/s1 |
| InChIKey | UCZLAFFRAYATTD-STCGNDQFSA-N |
| XLogP | 4.58 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|