C24H30N2O2 — CID 14347407
(2E,4E)-5-(4-methoxyphenyl)-N-[(2R)-5-pyridin-3-ylpentan-2-yl]hepta-2,4-dienamide (PubChem CID 14347407) has the molecular formula C24H30N2O2 and a molecular weight of 378.52 g/mol. Its IUPAC name is (2E,4E)-5-(4-methoxyphenyl)-N-[(2R)-5-pyridin-3-ylpentan-2-yl]hepta-2,4-dienamide.
| Compound Name | (2E,4E)-5-(4-methoxyphenyl)-N-[(2R)-5-pyridin-3-ylpentan-2-yl]hepta-2,4-dienamide |
|---|---|
| PubChem CID | 14347407 |
| Molecular Formula | C24H30N2O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | (2E,4E)-5-(4-methoxyphenyl)-N-[(2R)-5-pyridin-3-ylpentan-2-yl]hepta-2,4-dienamide |
| SMILES | CC/C(=C\C=C\C(=O)N[C@H](C)CCCc1cccnc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C24H30N2O2/c1-4-21(22-13-15-23(28-3)16-14-22)11-6-12-24(27)26-19(2)8-5-9-20-10-7-17-25-18-20/h6-7,10-19H,4-5,8-9H2,1-3H3,(H,26,27)/b12-6+,21-11+/t19-/m1/s1 |
| InChIKey | GMPSNLDXAQIXBD-PGAGZYBASA-N |
| XLogP | 4.97 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|