C24H26ClF5N2 — CID 143474323
(1S,3E,5Z)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(2,2,3,3-tetrafluoropropyl)phenyl]-3,6-dimethylocta-3,5-dien-1-amine (PubChem CID 143474323) has the molecular formula C24H26ClF5N2 and a molecular weight of 472.93 g/mol. Its IUPAC name is (1S,3E,5Z)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(2,2,3,3-tetrafluoropropyl)phenyl]-3,6-dimethylocta-3,5-dien-1-amine.
| Compound Name | (1S,3E,5Z)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(2,2,3,3-tetrafluoropropyl)phenyl]-3,6-dimethylocta-3,5-dien-1-amine |
|---|---|
| PubChem CID | 143474323 |
| Molecular Formula | C24H26ClF5N2 |
| Molecular Weight | 472.93 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | (1S,3E,5Z)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(2,2,3,3-tetrafluoropropyl)phenyl]-3,6-dimethylocta-3,5-dien-1-amine |
| SMILES | CC/C(C)=C\C=C(/C)C[C@](N)(c1cc(F)cc(CC(F)(F)C(F)F)c1)c1ccc(Cl)cn1 |
| InChI | InChI=1S/C24H26ClF5N2/c1-4-15(2)5-6-16(3)12-23(31,21-8-7-19(25)14-32-21)18-9-17(10-20(26)11-18)13-24(29,30)22(27)28/h5-11,14,22H,4,12-13,31H2,1-3H3/b15-5-,16-6+/t23-/m0/s1 |
| InChIKey | KBQKUYQZRCCSCY-UXHWFNLBSA-N |
| XLogP | 7.21 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.93 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|