About (2E)-5,5-bis(4-methoxyphenyl)-N-(4-pyridin-3-ylphenyl)penta-2,4-dienamide
(2E)-5,5-bis(4-methoxyphenyl)-N-(4-pyridin-3-ylphenyl)penta-2,4-dienamide (PubChem CID 14347434) has the molecular formula C30H26N2O3
and a molecular weight of 462.55 g/mol. Its IUPAC name is (2E)-5,5-bis(4-methoxyphenyl)-N-(4-pyridin-3-ylphenyl)penta-2,4-dienamide.
Molecular Properties
| Compound Name | (2E)-5,5-bis(4-methoxyphenyl)-N-(4-pyridin-3-ylphenyl)penta-2,4-dienamide |
| PubChem CID | 14347434 |
| Molecular Formula | C30H26N2O3 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | (2E)-5,5-bis(4-methoxyphenyl)-N-(4-pyridin-3-ylphenyl)penta-2,4-dienamide |
| SMILES | COc1ccc(C(=C/C=C/C(=O)Nc2ccc(-c3cccnc3)cc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C30H26N2O3/c1-34-27-16-10-23(11-17-27)29(24-12-18-28(35-2)19-13-24)6-3-7-30(33)32-26-14-8-22(9-15-26)25-5-4-20-31-21-25/h3-21H,1-2H3,(H,32,33)/b7-3+ |
| InChIKey | AHPDSBLXHZAIHR-XVNBXDOJSA-N |
| XLogP | 6.39 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-5,5-bis(4-methoxyphenyl)-N-(4-pyridin-3-ylphenyl)penta-2,4-dienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-5,5-bis(4-methoxyphenyl)-N-(4-pyridin-3-ylphenyl)penta-2,4-dienamide?
The IUPAC name of (2E)-5,5-bis(4-methoxyphenyl)-N-(4-pyridin-3-ylphenyl)penta-2,4-dienamide (CID 14347434) is (2E)-5,5-bis(4-methoxyphenyl)-N-(4-pyridin-3-ylphenyl)penta-2,4-dienamide.
What is the SMILES notation for (2E)-5,5-bis(4-methoxyphenyl)-N-(4-pyridin-3-ylphenyl)penta-2,4-dienamide?
The canonical SMILES for (2E)-5,5-bis(4-methoxyphenyl)-N-(4-pyridin-3-ylphenyl)penta-2,4-dienamide is COc1ccc(C(=C/C=C/C(=O)Nc2ccc(-c3cccnc3)cc2)c2ccc(OC)cc2)cc1.
What is the InChIKey of (2E)-5,5-bis(4-methoxyphenyl)-N-(4-pyridin-3-ylphenyl)penta-2,4-dienamide?
The InChIKey is AHPDSBLXHZAIHR-XVNBXDOJSA-N. The full InChI is InChI=1S/C30H26N2O3/c1-34-27-16-10-23(11-17-27)29(24-12-18-28(35-2)19-13-24)6-3-7-30(33)32-26-14-8-22(9-15-26)25-5-4-20-31-21-25/h3-21H,1-2H3,(H,32,33)/b7-3+.
What are the key properties of (2E)-5,5-bis(4-methoxyphenyl)-N-(4-pyridin-3-ylphenyl)penta-2,4-dienamide?
(2E)-5,5-bis(4-methoxyphenyl)-N-(4-pyridin-3-ylphenyl)penta-2,4-dienamide has a molecular weight of 462.55 g/mol, XLogP of 6.39, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-5,5-bis(4-methoxyphenyl)-N-(4-pyridin-3-ylphenyl)penta-2,4-dienamide is sourced from PubChem (CID 14347434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).