About 3-hydroxy-3,3-bis[2-(trifluoromethyl)phenyl]propanenitrile
3-hydroxy-3,3-bis[2-(trifluoromethyl)phenyl]propanenitrile (PubChem CID 14347486) has the molecular formula C17H11F6NO
and a molecular weight of 359.27 g/mol. Its IUPAC name is 3-hydroxy-3,3-bis[2-(trifluoromethyl)phenyl]propanenitrile.
Molecular Properties
| Compound Name | 3-hydroxy-3,3-bis[2-(trifluoromethyl)phenyl]propanenitrile |
| PubChem CID | 14347486 |
| Molecular Formula | C17H11F6NO |
| Molecular Weight | 359.27 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | 3-hydroxy-3,3-bis[2-(trifluoromethyl)phenyl]propanenitrile |
| SMILES | N#CCC(O)(c1ccccc1C(F)(F)F)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C17H11F6NO/c18-16(19,20)13-7-3-1-5-11(13)15(25,9-10-24)12-6-2-4-8-14(12)17(21,22)23/h1-8,25H,9H2 |
| InChIKey | SVDTVSGELABMPS-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.27 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-hydroxy-3,3-bis[2-(trifluoromethyl)phenyl]propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-3,3-bis[2-(trifluoromethyl)phenyl]propanenitrile?
The IUPAC name of 3-hydroxy-3,3-bis[2-(trifluoromethyl)phenyl]propanenitrile (CID 14347486) is 3-hydroxy-3,3-bis[2-(trifluoromethyl)phenyl]propanenitrile.
What is the SMILES notation for 3-hydroxy-3,3-bis[2-(trifluoromethyl)phenyl]propanenitrile?
The canonical SMILES for 3-hydroxy-3,3-bis[2-(trifluoromethyl)phenyl]propanenitrile is N#CCC(O)(c1ccccc1C(F)(F)F)c1ccccc1C(F)(F)F.
What is the InChIKey of 3-hydroxy-3,3-bis[2-(trifluoromethyl)phenyl]propanenitrile?
The InChIKey is SVDTVSGELABMPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11F6NO/c18-16(19,20)13-7-3-1-5-11(13)15(25,9-10-24)12-6-2-4-8-14(12)17(21,22)23/h1-8,25H,9H2.
What are the key properties of 3-hydroxy-3,3-bis[2-(trifluoromethyl)phenyl]propanenitrile?
3-hydroxy-3,3-bis[2-(trifluoromethyl)phenyl]propanenitrile has a molecular weight of 359.27 g/mol, XLogP of 4.87, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-3,3-bis[2-(trifluoromethyl)phenyl]propanenitrile is sourced from PubChem (CID 14347486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).