C17H23IN6O2S — CID 143475223
N-[(3,4-dimethoxyphenyl)methyl]-N'-[3-(1λ3-ioda-2,5-diazacyclopenta-3,5-dien-2-yl)-1,2,4-thiadiazol-5-yl]-N'-methylpropane-1,3-diamine (PubChem CID 143475223) has the molecular formula C17H23IN6O2S and a molecular weight of 502.38 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-N'-[3-(1λ3-ioda-2,5-diazacyclopenta-3,5-dien-2-yl)-1,2,4-thiadiazol-5-yl]-N'-methylpropane-1,3-diamine.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-N'-[3-(1λ3-ioda-2,5-diazacyclopenta-3,5-dien-2-yl)-1,2,4-thiadiazol-5-yl]-N'-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 143475223 |
| Molecular Formula | C17H23IN6O2S |
| Molecular Weight | 502.38 g/mol |
| Exact Mass | 502.06 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-N'-[3-(1λ3-ioda-2,5-diazacyclopenta-3,5-dien-2-yl)-1,2,4-thiadiazol-5-yl]-N'-methylpropane-1,3-diamine |
| SMILES | COc1ccc(CNCCCN(C)c2nc(N3C=CN=I3)ns2)cc1OC |
| InChI | InChI=1S/C17H23IN6O2S/c1-23(17-21-16(22-27-17)24-10-8-20-18-24)9-4-7-19-12-13-5-6-14(25-2)15(11-13)26-3/h5-6,8,10-11,19H,4,7,9,12H2,1-3H3 |
| InChIKey | MZWJZHZDGCTYTR-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.38 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|