About 5-bromo-1H-indazole;ethane
5-bromo-1H-indazole;ethane (PubChem CID 143475465) has the molecular formula C9H11BrN2
and a molecular weight of 227.11 g/mol. Its IUPAC name is 5-bromo-1H-indazole;ethane.
Molecular Properties
| Compound Name | 5-bromo-1H-indazole;ethane |
| PubChem CID | 143475465 |
| Molecular Formula | C9H11BrN2 |
| Molecular Weight | 227.11 g/mol |
| Exact Mass | 226.01 |
| IUPAC Name | 5-bromo-1H-indazole;ethane |
| SMILES | Brc1ccc2[nH]ncc2c1.CC |
| InChI | InChI=1S/C7H5BrN2.C2H6/c8-6-1-2-7-5(3-6)4-9-10-7;1-2/h1-4H,(H,9,10);1-2H3 |
| InChIKey | LBDOZMGICJYRAZ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.11 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-bromo-1H-indazole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-1H-indazole;ethane?
The IUPAC name of 5-bromo-1H-indazole;ethane (CID 143475465) is 5-bromo-1H-indazole;ethane.
What is the SMILES notation for 5-bromo-1H-indazole;ethane?
The canonical SMILES for 5-bromo-1H-indazole;ethane is Brc1ccc2[nH]ncc2c1.CC.
What is the InChIKey of 5-bromo-1H-indazole;ethane?
The InChIKey is LBDOZMGICJYRAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5BrN2.C2H6/c8-6-1-2-7-5(3-6)4-9-10-7;1-2/h1-4H,(H,9,10);1-2H3.
What are the key properties of 5-bromo-1H-indazole;ethane?
5-bromo-1H-indazole;ethane has a molecular weight of 227.11 g/mol, XLogP of 3.35, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-1H-indazole;ethane is sourced from PubChem (CID 143475465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).