C21H32F3N3 — CID 143476746
(5E,7E,9E)-3-ethyl-N-[1-(1H-pyrazol-4-yl)prop-2-enyl]-10-(trifluoromethyl)dodeca-5,7,9,11-tetraen-1-amine;molecular hydrogen (PubChem CID 143476746) has the molecular formula C21H32F3N3 and a molecular weight of 383.50 g/mol. Its IUPAC name is (5E,7E,9E)-3-ethyl-N-[1-(1H-pyrazol-4-yl)prop-2-enyl]-10-(trifluoromethyl)dodeca-5,7,9,11-tetraen-1-amine;molecular hydrogen.
| Compound Name | (5E,7E,9E)-3-ethyl-N-[1-(1H-pyrazol-4-yl)prop-2-enyl]-10-(trifluoromethyl)dodeca-5,7,9,11-tetraen-1-amine;molecular hydrogen |
|---|---|
| PubChem CID | 143476746 |
| Molecular Formula | C21H32F3N3 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.25 |
| IUPAC Name | (5E,7E,9E)-3-ethyl-N-[1-(1H-pyrazol-4-yl)prop-2-enyl]-10-(trifluoromethyl)dodeca-5,7,9,11-tetraen-1-amine;molecular hydrogen |
| SMILES | C=C/C(=C\C=C\C=C\CC(CC)CCNC(C=C)c1cn[nH]c1)C(F)(F)F.[H][H].[H][H] |
| InChI | InChI=1S/C21H28F3N3.2H2/c1-4-17(13-14-25-20(6-3)18-15-26-27-16-18)11-9-7-8-10-12-19(5-2)21(22,23)24;;/h5-10,12,15-17,20,25H,2-4,11,13-14H2,1H3,(H,26,27);2*1H/b9-7+,10-8+,19-12+;; |
| InChIKey | USNBIVQQQWYBSD-VEFVEACUSA-N |
| XLogP | 6.31 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|