C25H42N2O — CID 143476756
(6S,8E,10Z)-6-ethyl-3-methyl-1-[[(5E,7Z)-4-methyl-2,3,4,9-tetrahydro-1H-azonin-6-yl]amino]trideca-8,10,12-trien-1-ol (PubChem CID 143476756) has the molecular formula C25H42N2O and a molecular weight of 386.62 g/mol. Its IUPAC name is (6S,8E,10Z)-6-ethyl-3-methyl-1-[[(5E,7Z)-4-methyl-2,3,4,9-tetrahydro-1H-azonin-6-yl]amino]trideca-8,10,12-trien-1-ol.
| Compound Name | (6S,8E,10Z)-6-ethyl-3-methyl-1-[[(5E,7Z)-4-methyl-2,3,4,9-tetrahydro-1H-azonin-6-yl]amino]trideca-8,10,12-trien-1-ol |
|---|---|
| PubChem CID | 143476756 |
| Molecular Formula | C25H42N2O |
| Molecular Weight | 386.62 g/mol |
| Exact Mass | 386.33 |
| IUPAC Name | (6S,8E,10Z)-6-ethyl-3-methyl-1-[[(5E,7Z)-4-methyl-2,3,4,9-tetrahydro-1H-azonin-6-yl]amino]trideca-8,10,12-trien-1-ol |
| SMILES | C=C/C=C\C=C\C[C@@H](CC)CCC(C)CC(O)NC1=C/C(C)CCNC/C=C\1 |
| InChI | InChI=1S/C25H42N2O/c1-5-7-8-9-10-12-23(6-2)15-14-21(3)20-25(28)27-24-13-11-17-26-18-16-22(4)19-24/h5,7-11,13,19,21-23,25-28H,1,6,12,14-18,20H2,2-4H3/b8-7-,10-9+,13-11-,24-19+/t21?,22?,23-,25?/m1/s1 |
| InChIKey | SHOZTPXABJYDBY-MMKWIFKWSA-N |
| XLogP | 5.49 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.62 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|