C16H22N2 — CID 143476990
[(7Z)-3-ethenyl-7-ethylidene-2-[(Z)-prop-1-enyl]-3a,4,5,6-tetrahydroinden-1-yl]hydrazine (PubChem CID 143476990) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is [(7Z)-3-ethenyl-7-ethylidene-2-[(Z)-prop-1-enyl]-3a,4,5,6-tetrahydroinden-1-yl]hydrazine.
| Compound Name | [(7Z)-3-ethenyl-7-ethylidene-2-[(Z)-prop-1-enyl]-3a,4,5,6-tetrahydroinden-1-yl]hydrazine |
|---|---|
| PubChem CID | 143476990 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | [(7Z)-3-ethenyl-7-ethylidene-2-[(Z)-prop-1-enyl]-3a,4,5,6-tetrahydroinden-1-yl]hydrazine |
| SMILES | C=CC1=C(/C=C\C)C(NN)=C2/C(=C\C)CCCC12 |
| InChI | InChI=1S/C16H22N2/c1-4-8-14-12(6-3)13-10-7-9-11(5-2)15(13)16(14)18-17/h4-6,8,13,18H,3,7,9-10,17H2,1-2H3/b8-4-,11-5- |
| InChIKey | GACJAFIYXDXPNZ-JLYKOKMVSA-N |
| XLogP | 3.52 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|