C22H27Cl2N7O — CID 143477254
1-[4-[7-[(2,4-dichlorophenyl)methylamino]pyrazolo[1,5-a]pyrimidin-5-yl]piperazin-1-yl]-2-(propylamino)ethanone (PubChem CID 143477254) has the molecular formula C22H27Cl2N7O and a molecular weight of 476.41 g/mol. Its IUPAC name is 1-[4-[7-[(2,4-dichlorophenyl)methylamino]pyrazolo[1,5-a]pyrimidin-5-yl]piperazin-1-yl]-2-(propylamino)ethanone.
| Compound Name | 1-[4-[7-[(2,4-dichlorophenyl)methylamino]pyrazolo[1,5-a]pyrimidin-5-yl]piperazin-1-yl]-2-(propylamino)ethanone |
|---|---|
| PubChem CID | 143477254 |
| Molecular Formula | C22H27Cl2N7O |
| Molecular Weight | 476.41 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | 1-[4-[7-[(2,4-dichlorophenyl)methylamino]pyrazolo[1,5-a]pyrimidin-5-yl]piperazin-1-yl]-2-(propylamino)ethanone |
| SMILES | CCCNCC(=O)N1CCN(c2cc(NCc3ccc(Cl)cc3Cl)n3nccc3n2)CC1 |
| InChI | InChI=1S/C22H27Cl2N7O/c1-2-6-25-15-22(32)30-10-8-29(9-11-30)21-13-20(31-19(28-21)5-7-27-31)26-14-16-3-4-17(23)12-18(16)24/h3-5,7,12-13,25-26H,2,6,8-11,14-15H2,1H3 |
| InChIKey | ATXBWTPNBGKTGA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 77.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.41 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|