C17H22Cl2N4OS — CID 143477318
N-[(2,4-dichlorophenyl)methyl]-2-methylsulfanyl-5,6,7,8-tetrahydropyrimido[5,4-f][1,4]oxazepin-4-amine;ethane (PubChem CID 143477318) has the molecular formula C17H22Cl2N4OS and a molecular weight of 401.36 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methyl]-2-methylsulfanyl-5,6,7,8-tetrahydropyrimido[5,4-f][1,4]oxazepin-4-amine;ethane.
| Compound Name | N-[(2,4-dichlorophenyl)methyl]-2-methylsulfanyl-5,6,7,8-tetrahydropyrimido[5,4-f][1,4]oxazepin-4-amine;ethane |
|---|---|
| PubChem CID | 143477318 |
| Molecular Formula | C17H22Cl2N4OS |
| Molecular Weight | 401.36 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methyl]-2-methylsulfanyl-5,6,7,8-tetrahydropyrimido[5,4-f][1,4]oxazepin-4-amine;ethane |
| SMILES | CC.CSc1nc(NCc2ccc(Cl)cc2Cl)c2c(n1)OCCNC2 |
| InChI | InChI=1S/C15H16Cl2N4OS.C2H6/c1-23-15-20-13(11-8-18-4-5-22-14(11)21-15)19-7-9-2-3-10(16)6-12(9)17;1-2/h2-3,6,18H,4-5,7-8H2,1H3,(H,19,20,21);1-2H3 |
| InChIKey | OCCNNZPPKXGRFV-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.36 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |