C13H17N3 — CID 143477468
ethane;2-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-1,3,5-triazine (PubChem CID 143477468) has the molecular formula C13H17N3 and a molecular weight of 215.30 g/mol. Its IUPAC name is ethane;2-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-1,3,5-triazine.
| Compound Name | ethane;2-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-1,3,5-triazine |
|---|---|
| PubChem CID | 143477468 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | ethane;2-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-1,3,5-triazine |
| SMILES | C=C/C=C\C(=C/C=C)c1ncncn1.CC |
| InChI | InChI=1S/C11H11N3.C2H6/c1-3-5-7-10(6-4-2)11-13-8-12-9-14-11;1-2/h3-9H,1-2H2;1-2H3/b7-5-,10-6+; |
| InChIKey | FBAIVJLDTYNAOC-RQLYHSFASA-N |
| XLogP | 3.21 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|