About 3-methyl-8H-imidazo[4,5-b]azepine
3-methyl-8H-imidazo[4,5-b]azepine (PubChem CID 143478204) has the molecular formula C8H9N3
and a molecular weight of 147.18 g/mol. Its IUPAC name is 3-methyl-8H-imidazo[4,5-b]azepine.
Molecular Properties
| Compound Name | 3-methyl-8H-imidazo[4,5-b]azepine |
| PubChem CID | 143478204 |
| Molecular Formula | C8H9N3 |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.08 |
| IUPAC Name | 3-methyl-8H-imidazo[4,5-b]azepine |
| SMILES | Cn1cnc2c1N=CC=CC2 |
| InChI | InChI=1S/C8H9N3/c1-11-6-10-7-4-2-3-5-9-8(7)11/h2-3,5-6H,4H2,1H3 |
| InChIKey | PJDJBMPLEGHEIO-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methyl-8H-imidazo[4,5-b]azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-8H-imidazo[4,5-b]azepine?
The IUPAC name of 3-methyl-8H-imidazo[4,5-b]azepine (CID 143478204) is 3-methyl-8H-imidazo[4,5-b]azepine.
What is the SMILES notation for 3-methyl-8H-imidazo[4,5-b]azepine?
The canonical SMILES for 3-methyl-8H-imidazo[4,5-b]azepine is Cn1cnc2c1N=CC=CC2.
What is the InChIKey of 3-methyl-8H-imidazo[4,5-b]azepine?
The InChIKey is PJDJBMPLEGHEIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3/c1-11-6-10-7-4-2-3-5-9-8(7)11/h2-3,5-6H,4H2,1H3.
What are the key properties of 3-methyl-8H-imidazo[4,5-b]azepine?
3-methyl-8H-imidazo[4,5-b]azepine has a molecular weight of 147.18 g/mol, XLogP of 1.23, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-8H-imidazo[4,5-b]azepine is sourced from PubChem (CID 143478204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).