C32H44ClF3N4O3S2 — CID 143478226
acetylene;ethane;methyl (3E)-3-[[2-[4-[4-[3-tert-butyl-5-(trifluoromethylsulfanyl)phenyl]-5-chloro-1,3-thiazol-2-yl]piperidin-1-yl]-2-oxoethyl]-ethylhydrazinylidene]butanoate (PubChem CID 143478226) has the molecular formula C32H44ClF3N4O3S2 and a molecular weight of 689.31 g/mol. Its IUPAC name is acetylene;ethane;methyl (3E)-3-[[2-[4-[4-[3-tert-butyl-5-(trifluoromethylsulfanyl)phenyl]-5-chloro-1,3-thiazol-2-yl]piperidin-1-yl]-2-oxoethyl]-ethylhydrazinylidene]butanoate.
| Compound Name | acetylene;ethane;methyl (3E)-3-[[2-[4-[4-[3-tert-butyl-5-(trifluoromethylsulfanyl)phenyl]-5-chloro-1,3-thiazol-2-yl]piperidin-1-yl]-2-oxoethyl]-ethylhydrazinylidene]butanoate |
|---|---|
| PubChem CID | 143478226 |
| Molecular Formula | C32H44ClF3N4O3S2 |
| Molecular Weight | 689.31 g/mol |
| Exact Mass | 688.25 |
| IUPAC Name | acetylene;ethane;methyl (3E)-3-[[2-[4-[4-[3-tert-butyl-5-(trifluoromethylsulfanyl)phenyl]-5-chloro-1,3-thiazol-2-yl]piperidin-1-yl]-2-oxoethyl]-ethylhydrazinylidene]butanoate |
| SMILES | C#C.CC.CCN(CC(=O)N1CCC(c2nc(-c3cc(SC(F)(F)F)cc(C(C)(C)C)c3)c(Cl)s2)CC1)/N=C(\C)CC(=O)OC |
| InChI | InChI=1S/C28H36ClF3N4O3S2.C2H6.C2H2/c1-7-36(34-17(2)12-23(38)39-6)16-22(37)35-10-8-18(9-11-35)26-33-24(25(29)40-26)19-13-20(27(3,4)5)15-21(14-19)41-28(30,31)32;2*1-2/h13-15,18H,7-12,16H2,1-6H3;1-2H3;1-2H/b34-17+;; |
| InChIKey | ZVJUBCHOAKNYBY-OBPZKHQOSA-N |
| XLogP | 8.62 |
| TPSA | 75.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.31 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|